About 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine
2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine (PubChem CID 80975520) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine |
| PubChem CID | 80975520 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine |
| SMILES | Cc1ccc(-c2nc(C(C)(C)C)nc(N)c2C)cc1C |
| InChI | InChI=1S/C17H23N3/c1-10-7-8-13(9-11(10)2)14-12(3)15(18)20-16(19-14)17(4,5)6/h7-9H,1-6H3,(H2,18,19,20) |
| InChIKey | JQFCNPNMEBFYLO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine?
The IUPAC name of 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine (CID 80975520) is 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine.
What is the SMILES notation for 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine?
The canonical SMILES for 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine is Cc1ccc(-c2nc(C(C)(C)C)nc(N)c2C)cc1C.
What is the InChIKey of 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine?
The InChIKey is JQFCNPNMEBFYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c1-10-7-8-13(9-11(10)2)14-12(3)15(18)20-16(19-14)17(4,5)6/h7-9H,1-6H3,(H2,18,19,20).
What are the key properties of 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine?
2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine has a molecular weight of 269.39 g/mol, XLogP of 3.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(3,4-dimethylphenyl)-5-methylpyrimidin-4-amine is sourced from PubChem (CID 80975520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).