C15H21N3S — CID 80976401
5-methyl-N,2-dipropyl-6-thiophen-3-ylpyrimidin-4-amine (PubChem CID 80976401) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 5-methyl-N,2-dipropyl-6-thiophen-3-ylpyrimidin-4-amine.
| Compound Name | 5-methyl-N,2-dipropyl-6-thiophen-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80976401 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5-methyl-N,2-dipropyl-6-thiophen-3-ylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CCC)nc(-c2ccsc2)c1C |
| InChI | InChI=1S/C15H21N3S/c1-4-6-13-17-14(12-7-9-19-10-12)11(3)15(18-13)16-8-5-2/h7,9-10H,4-6,8H2,1-3H3,(H,16,17,18) |
| InChIKey | OTRSLMCUHVFXQC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |