C15H19IN4 — CID 80976899
4-N-(2-iodophenyl)-6-N,5-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 80976899) has the molecular formula C15H19IN4 and a molecular weight of 382.25 g/mol. Its IUPAC name is 4-N-(2-iodophenyl)-6-N,5-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-iodophenyl)-6-N,5-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80976899 |
| Molecular Formula | C15H19IN4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-N-(2-iodophenyl)-6-N,5-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CNc1nc(C(C)C)nc(Nc2ccccc2I)c1C |
| InChI | InChI=1S/C15H19IN4/c1-9(2)13-19-14(17-4)10(3)15(20-13)18-12-8-6-5-7-11(12)16/h5-9H,1-4H3,(H2,17,18,19,20) |
| InChIKey | SCZDIHJHOOPWTJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|