About 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine
2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine (PubChem CID 80977836) has the molecular formula C18H25N3
and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine |
| PubChem CID | 80977836 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(C(C)(C)C)nc(-c2cc(C)ccc2C)c1C |
| InChI | InChI=1S/C18H25N3/c1-11-8-9-12(2)14(10-11)15-13(3)16(19-7)21-17(20-15)18(4,5)6/h8-10H,1-7H3,(H,19,20,21) |
| InChIKey | WPTVFLLVQHHZNI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine?
The IUPAC name of 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine (CID 80977836) is 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine.
What is the SMILES notation for 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine?
The canonical SMILES for 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine is CNc1nc(C(C)(C)C)nc(-c2cc(C)ccc2C)c1C.
What is the InChIKey of 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine?
The InChIKey is WPTVFLLVQHHZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3/c1-11-8-9-12(2)14(10-11)15-13(3)16(19-7)21-17(20-15)18(4,5)6/h8-10H,1-7H3,(H,19,20,21).
What are the key properties of 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine?
2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine has a molecular weight of 283.42 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(2,5-dimethylphenyl)-N,5-dimethylpyrimidin-4-amine is sourced from PubChem (CID 80977836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).