About 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine
2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine (PubChem CID 80978807) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine |
| PubChem CID | 80978807 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine |
| SMILES | CCc1nc(NC)c(C)c(-c2ccc(OC(C)C)cc2)n1 |
| InChI | InChI=1S/C17H23N3O/c1-6-15-19-16(12(4)17(18-5)20-15)13-7-9-14(10-8-13)21-11(2)3/h7-11H,6H2,1-5H3,(H,18,19,20) |
| InChIKey | HUSIQZBRRCPBDM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine?
The IUPAC name of 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine (CID 80978807) is 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine.
What is the SMILES notation for 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine?
The canonical SMILES for 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine is CCc1nc(NC)c(C)c(-c2ccc(OC(C)C)cc2)n1.
What is the InChIKey of 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine?
The InChIKey is HUSIQZBRRCPBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-6-15-19-16(12(4)17(18-5)20-15)13-7-9-14(10-8-13)21-11(2)3/h7-11H,6H2,1-5H3,(H,18,19,20).
What are the key properties of 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine?
2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine has a molecular weight of 285.39 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,5-dimethyl-6-(4-propan-2-yloxyphenyl)pyrimidin-4-amine is sourced from PubChem (CID 80978807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).