C10H13F3N4O — CID 80978953
[2-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine (PubChem CID 80978953) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is [2-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80978953 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [2-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine |
| SMILES | CC(Oc1cc(NN)nc(C2CC2)n1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O/c1-5(10(11,12)13)18-8-4-7(17-14)15-9(16-8)6-2-3-6/h4-6H,2-3,14H2,1H3,(H,15,16,17) |
| InChIKey | AERVYHPFTYFIGY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|