C10H11N5S2 — CID 80979587
[2-cyclopropyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine (PubChem CID 80979587) has the molecular formula C10H11N5S2 and a molecular weight of 265.37 g/mol. Its IUPAC name is [2-cyclopropyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-cyclopropyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80979587 |
| Molecular Formula | C10H11N5S2 |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | [2-cyclopropyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(Sc2nccs2)nc(C2CC2)n1 |
| InChI | InChI=1S/C10H11N5S2/c11-15-7-5-8(17-10-12-3-4-16-10)14-9(13-7)6-1-2-6/h3-6H,1-2,11H2,(H,13,14,15) |
| InChIKey | OPVJSUUEQSZGKM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|