C12H22N2O4 — CID 80979649
tert-butyl (2R)-2-(morpholine-4-carbonylamino)propanoate (PubChem CID 80979649) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-(morpholine-4-carbonylamino)propanoate.
| Compound Name | tert-butyl (2R)-2-(morpholine-4-carbonylamino)propanoate |
|---|---|
| PubChem CID | 80979649 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | tert-butyl (2R)-2-(morpholine-4-carbonylamino)propanoate |
| SMILES | C[C@@H](NC(=O)N1CCOCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O4/c1-9(10(15)18-12(2,3)4)13-11(16)14-5-7-17-8-6-14/h9H,5-8H2,1-4H3,(H,13,16)/t9-/m1/s1 |
| InChIKey | FJDREWYRNOKIPQ-SECBINFHSA-N |
| XLogP | 0.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |