About [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine
[2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80980070) has the molecular formula C13H12F2N4S
and a molecular weight of 294.33 g/mol. Its IUPAC name is [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine |
| PubChem CID | 80980070 |
| Molecular Formula | C13H12F2N4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(Sc2ccc(F)cc2F)nc(C2CC2)n1 |
| InChI | InChI=1S/C13H12F2N4S/c14-8-3-4-10(9(15)5-8)20-12-6-11(19-16)17-13(18-12)7-1-2-7/h3-7H,1-2,16H2,(H,17,18,19) |
| InChIKey | SNOXZUWYOLNLHF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine?
The IUPAC name of [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine (CID 80980070) is [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine is NNc1cc(Sc2ccc(F)cc2F)nc(C2CC2)n1.
What is the InChIKey of [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine?
The InChIKey is SNOXZUWYOLNLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N4S/c14-8-3-4-10(9(15)5-8)20-12-6-11(19-16)17-13(18-12)7-1-2-7/h3-7H,1-2,16H2,(H,17,18,19).
What are the key properties of [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine?
[2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine has a molecular weight of 294.33 g/mol, XLogP of 3.07, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyclopropyl-6-(2,4-difluorophenyl)sulfanylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 80980070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).