C13H15BrFNO2 — CID 80980336
N-[(5-bromo-2-fluorophenyl)methyl]-5-methyloxolane-2-carboxamide (PubChem CID 80980336) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-5-methyloxolane-2-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 80980336 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-5-methyloxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)NCc2cc(Br)ccc2F)O1 |
| InChI | InChI=1S/C13H15BrFNO2/c1-8-2-5-12(18-8)13(17)16-7-9-6-10(14)3-4-11(9)15/h3-4,6,8,12H,2,5,7H2,1H3,(H,16,17) |
| InChIKey | PXGMKHPUUZDXEY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |