C13H23N5O — CID 80982285
2-[(6-amino-2-tert-butyl-5-methylpyrimidin-4-yl)amino]-2-methylpropanamide (PubChem CID 80982285) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[(6-amino-2-tert-butyl-5-methylpyrimidin-4-yl)amino]-2-methylpropanamide.
| Compound Name | 2-[(6-amino-2-tert-butyl-5-methylpyrimidin-4-yl)amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 80982285 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-[(6-amino-2-tert-butyl-5-methylpyrimidin-4-yl)amino]-2-methylpropanamide |
| SMILES | Cc1c(N)nc(C(C)(C)C)nc1NC(C)(C)C(N)=O |
| InChI | InChI=1S/C13H23N5O/c1-7-8(14)16-11(12(2,3)4)17-9(7)18-13(5,6)10(15)19/h1-6H3,(H2,15,19)(H3,14,16,17,18) |
| InChIKey | ZMBORWHENOIWLQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |