C12H21N5 — CID 80983428
2-ethyl-N,5-dimethyl-6-piperazin-1-ylpyrimidin-4-amine (PubChem CID 80983428) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-ethyl-N,5-dimethyl-6-piperazin-1-ylpyrimidin-4-amine.
| Compound Name | 2-ethyl-N,5-dimethyl-6-piperazin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80983428 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 2-ethyl-N,5-dimethyl-6-piperazin-1-ylpyrimidin-4-amine |
| SMILES | CCc1nc(NC)c(C)c(N2CCNCC2)n1 |
| InChI | InChI=1S/C12H21N5/c1-4-10-15-11(13-3)9(2)12(16-10)17-7-5-14-6-8-17/h14H,4-8H2,1-3H3,(H,13,15,16) |
| InChIKey | UCWQENWPTGJPPO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |