C15H28N4S — CID 80984789
5-methyl-4-N-(3-methylsulfanylpropyl)-2-propan-2-yl-6-N-propylpyrimidine-4,6-diamine (PubChem CID 80984789) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is 5-methyl-4-N-(3-methylsulfanylpropyl)-2-propan-2-yl-6-N-propylpyrimidine-4,6-diamine.
| Compound Name | 5-methyl-4-N-(3-methylsulfanylpropyl)-2-propan-2-yl-6-N-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80984789 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 5-methyl-4-N-(3-methylsulfanylpropyl)-2-propan-2-yl-6-N-propylpyrimidine-4,6-diamine |
| SMILES | CCCNc1nc(C(C)C)nc(NCCCSC)c1C |
| InChI | InChI=1S/C15H28N4S/c1-6-8-16-14-12(4)15(17-9-7-10-20-5)19-13(18-14)11(2)3/h11H,6-10H2,1-5H3,(H2,16,17,18,19) |
| InChIKey | PLYNVFIDIGJTHY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|