C14H23N5O — CID 80986210
2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]-N-propylpropanamide (PubChem CID 80986210) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]-N-propylpropanamide.
| Compound Name | 2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 80986210 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1nc(C2CC2)nc(N)c1C |
| InChI | InChI=1S/C14H23N5O/c1-4-7-16-14(20)9(3)17-12-8(2)11(15)18-13(19-12)10-5-6-10/h9-10H,4-7H2,1-3H3,(H,16,20)(H3,15,17,18,19) |
| InChIKey | QWFVPFODZJBODS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |