C15H17BrFN3O — CID 80988471
6-(2-bromo-4-fluorophenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine (PubChem CID 80988471) has the molecular formula C15H17BrFN3O and a molecular weight of 354.22 g/mol. Its IUPAC name is 6-(2-bromo-4-fluorophenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-(2-bromo-4-fluorophenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80988471 |
| Molecular Formula | C15H17BrFN3O |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 6-(2-bromo-4-fluorophenoxy)-2-tert-butyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(N)nc(C(C)(C)C)nc1Oc1ccc(F)cc1Br |
| InChI | InChI=1S/C15H17BrFN3O/c1-8-12(18)19-14(15(2,3)4)20-13(8)21-11-6-5-9(17)7-10(11)16/h5-7H,1-4H3,(H2,18,19,20) |
| InChIKey | WPFJHFFFXTWCAN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |