C12H17F4N3O — CID 80988667
2-tert-butyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine (PubChem CID 80988667) has the molecular formula C12H17F4N3O and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80988667 |
| Molecular Formula | C12H17F4N3O |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-tert-butyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
| SMILES | Cc1c(N)nc(C(C)(C)C)nc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H17F4N3O/c1-6-7(17)18-10(11(2,3)4)19-8(6)20-5-12(15,16)9(13)14/h9H,5H2,1-4H3,(H2,17,18,19) |
| InChIKey | DEPHCEPNKGJFBS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|