C13H23N3O — CID 80989070
2-ethyl-5-methyl-6-propan-2-yloxy-N-propylpyrimidin-4-amine (PubChem CID 80989070) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-ethyl-5-methyl-6-propan-2-yloxy-N-propylpyrimidin-4-amine.
| Compound Name | 2-ethyl-5-methyl-6-propan-2-yloxy-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80989070 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-ethyl-5-methyl-6-propan-2-yloxy-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CC)nc(OC(C)C)c1C |
| InChI | InChI=1S/C13H23N3O/c1-6-8-14-12-10(5)13(17-9(3)4)16-11(7-2)15-12/h9H,6-8H2,1-5H3,(H,14,15,16) |
| InChIKey | KMTQAXQIUGEURT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |