C15H17BrClN3O — CID 80989565
6-(2-bromo-4-chlorophenoxy)-N,2-diethyl-5-methylpyrimidin-4-amine (PubChem CID 80989565) has the molecular formula C15H17BrClN3O and a molecular weight of 370.68 g/mol. Its IUPAC name is 6-(2-bromo-4-chlorophenoxy)-N,2-diethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-(2-bromo-4-chlorophenoxy)-N,2-diethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80989565 |
| Molecular Formula | C15H17BrClN3O |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 6-(2-bromo-4-chlorophenoxy)-N,2-diethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(CC)nc(Oc2ccc(Cl)cc2Br)c1C |
| InChI | InChI=1S/C15H17BrClN3O/c1-4-13-19-14(18-5-2)9(3)15(20-13)21-12-7-6-10(17)8-11(12)16/h6-8H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | YAAYKMFJJYCULJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |