About 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole
3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole (PubChem CID 809897) has the molecular formula C21H17N3S
and a molecular weight of 343.46 g/mol. Its IUPAC name is 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole |
| PubChem CID | 809897 |
| Molecular Formula | C21H17N3S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole |
| SMILES | c1ccc(CSc2nnc(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3S/c1-4-10-17(11-5-1)16-25-21-23-22-20(18-12-6-2-7-13-18)24(21)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | RPCZTDBBHCHBNW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole?
The IUPAC name of 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole (CID 809897) is 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole.
What is the SMILES notation for 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole?
The canonical SMILES for 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole is c1ccc(CSc2nnc(-c3ccccc3)n2-c2ccccc2)cc1.
What is the InChIKey of 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole?
The InChIKey is RPCZTDBBHCHBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3S/c1-4-10-17(11-5-1)16-25-21-23-22-20(18-12-6-2-7-13-18)24(21)19-14-8-3-9-15-19/h1-15H,16H2.
What are the key properties of 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole?
3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole has a molecular weight of 343.46 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfanyl-4,5-diphenyl-1,2,4-triazole is sourced from PubChem (CID 809897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).