C14H16BrN3S — CID 80994557
6-(3-bromophenyl)sulfanyl-2-ethyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 80994557) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 6-(3-bromophenyl)sulfanyl-2-ethyl-N,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-(3-bromophenyl)sulfanyl-2-ethyl-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80994557 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 6-(3-bromophenyl)sulfanyl-2-ethyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | CCc1nc(NC)c(C)c(Sc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C14H16BrN3S/c1-4-12-17-13(16-3)9(2)14(18-12)19-11-7-5-6-10(15)8-11/h5-8H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | ZSAXJHBDCVRQHO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |