About 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid
2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 80996014) has the molecular formula C12H21F3N2O2
and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid.
Molecular Properties
| Compound Name | 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid |
| PubChem CID | 80996014 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | CCN1CCC(N(C)CC(C(=O)O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O2/c1-3-17-6-4-9(5-7-17)16(2)8-10(11(18)19)12(13,14)15/h9-10H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | VBLOKOOCYFVIDL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid?
The IUPAC name of 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid (CID 80996014) is 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid.
What is the SMILES notation for 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid?
The canonical SMILES for 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid is CCN1CCC(N(C)CC(C(=O)O)C(F)(F)F)CC1.
What is the InChIKey of 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid?
The InChIKey is VBLOKOOCYFVIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O2/c1-3-17-6-4-9(5-7-17)16(2)8-10(11(18)19)12(13,14)15/h9-10H,3-8H2,1-2H3,(H,18,19).
What are the key properties of 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid?
2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid has a molecular weight of 282.31 g/mol, XLogP of 1.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1-ethylpiperidin-4-yl)-methylamino]methyl]-3,3,3-trifluoropropanoic acid is sourced from PubChem (CID 80996014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).