C9H16N2O2 — CID 80996284
2-(3-aminopyrrolidin-1-yl)cyclobutane-1-carboxylic acid (PubChem CID 80996284) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(3-aminopyrrolidin-1-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(3-aminopyrrolidin-1-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 80996284 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-(3-aminopyrrolidin-1-yl)cyclobutane-1-carboxylic acid |
| SMILES | NC1CCN(C2CCC2C(=O)O)C1 |
| InChI | InChI=1S/C9H16N2O2/c10-6-3-4-11(5-6)8-2-1-7(8)9(12)13/h6-8H,1-5,10H2,(H,12,13) |
| InChIKey | WBVHXZFNDJYQLC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |