C10H13F3N2O4 — CID 80996415
2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 80996415) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 80996415 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(4-ethyl-2,3-dioxopiperazin-1-yl)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | CCN1CCN(CC(C(=O)O)C(F)(F)F)C(=O)C1=O |
| InChI | InChI=1S/C10H13F3N2O4/c1-2-14-3-4-15(8(17)7(14)16)5-6(9(18)19)10(11,12)13/h6H,2-5H2,1H3,(H,18,19) |
| InChIKey | VEQSVXQDVWTVGG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|