2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid

C10H16F3NO3 — CID 80997073

IUPAC2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid
SMILESCCC1COCCN1CC(C(=O)O)C(F)(F)F
InChIInChI=1S/C10H16F3NO3/c1-2-7-6-17-4-3-14(7)5-8(9(15)16)10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16)
InChIKeyLSIPJRNHNQHZKP-UHFFFAOYSA-N
MW255.24 g/mol
LogP1.36
Rot. Bonds4

About 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid

2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 80997073) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid.

Molecular Properties

Compound Name2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid
PubChem CID80997073
Molecular FormulaC10H16F3NO3
Molecular Weight255.24 g/mol
Exact Mass255.11
IUPAC Name2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid
SMILESCCC1COCCN1CC(C(=O)O)C(F)(F)F
InChIInChI=1S/C10H16F3NO3/c1-2-7-6-17-4-3-14(7)5-8(9(15)16)10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16)
InChIKeyLSIPJRNHNQHZKP-UHFFFAOYSA-N
XLogP1.36
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.24
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid?
The IUPAC name of 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid (CID 80997073) is 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid.
What is the SMILES notation for 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid?
The canonical SMILES for 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid is CCC1COCCN1CC(C(=O)O)C(F)(F)F.
What is the InChIKey of 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid?
The InChIKey is LSIPJRNHNQHZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO3/c1-2-7-6-17-4-3-14(7)5-8(9(15)16)10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16).
What are the key properties of 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid?
2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid has a molecular weight of 255.24 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-ethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanoic acid is sourced from PubChem (CID 80997073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).