C15H20FNO4 — CID 80998584
tert-butyl (2R)-2-[(4-fluoro-3-methoxybenzoyl)amino]propanoate (PubChem CID 80998584) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-fluoro-3-methoxybenzoyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(4-fluoro-3-methoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 80998584 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | tert-butyl (2R)-2-[(4-fluoro-3-methoxybenzoyl)amino]propanoate |
| SMILES | COc1cc(C(=O)N[C@H](C)C(=O)OC(C)(C)C)ccc1F |
| InChI | InChI=1S/C15H20FNO4/c1-9(14(19)21-15(2,3)4)17-13(18)10-6-7-11(16)12(8-10)20-5/h6-9H,1-5H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | IZSVUXXNXFJVLV-SECBINFHSA-N |
| XLogP | 2.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |