C13H21N3O4S — CID 80999314
tert-butyl (2S)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 80999314) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is tert-butyl (2S)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80999314 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | tert-butyl (2S)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | Cn1cnc(S(=O)(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C13H21N3O4S/c1-13(2,3)20-12(17)10-6-5-7-16(10)21(18,19)11-8-15(4)9-14-11/h8-10H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | PEDQIKACZNLRME-JTQLQIEISA-N |
| XLogP | 0.91 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |