C14H29N3 — CID 80999730
1-[2-(4-tert-butylpiperazin-1-yl)cyclobutyl]-N-methylmethanamine (PubChem CID 80999730) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 1-[2-(4-tert-butylpiperazin-1-yl)cyclobutyl]-N-methylmethanamine.
| Compound Name | 1-[2-(4-tert-butylpiperazin-1-yl)cyclobutyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 80999730 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 1-[2-(4-tert-butylpiperazin-1-yl)cyclobutyl]-N-methylmethanamine |
| SMILES | CNCC1CCC1N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H29N3/c1-14(2,3)17-9-7-16(8-10-17)13-6-5-12(13)11-15-4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | AZGMLEPGFBAYQT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |