C13H24N2O5S — CID 81000032
tert-butyl (2R)-2-[(1-methylsulfonylpyrrolidine-2-carbonyl)amino]propanoate (PubChem CID 81000032) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1-methylsulfonylpyrrolidine-2-carbonyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(1-methylsulfonylpyrrolidine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 81000032 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | tert-butyl (2R)-2-[(1-methylsulfonylpyrrolidine-2-carbonyl)amino]propanoate |
| SMILES | C[C@@H](NC(=O)C1CCCN1S(C)(=O)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O5S/c1-9(12(17)20-13(2,3)4)14-11(16)10-7-6-8-15(10)21(5,18)19/h9-10H,6-8H2,1-5H3,(H,14,16)/t9-,10?/m1/s1 |
| InChIKey | OYJLWEYIQJENJF-YHMJZVADSA-N |
| XLogP | 0.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |