C12H23N5 — CID 81001135
6-hydrazinyl-5-methyl-N-(2-methylpropyl)-2-propylpyrimidin-4-amine (PubChem CID 81001135) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-hydrazinyl-5-methyl-N-(2-methylpropyl)-2-propylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-5-methyl-N-(2-methylpropyl)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 81001135 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 6-hydrazinyl-5-methyl-N-(2-methylpropyl)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NN)c(C)c(NCC(C)C)n1 |
| InChI | InChI=1S/C12H23N5/c1-5-6-10-15-11(14-7-8(2)3)9(4)12(16-10)17-13/h8H,5-7,13H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | IVCYXISKSKEECO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|