C11H17F3N4O — CID 81001538
[5-methyl-2-propyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine (PubChem CID 81001538) has the molecular formula C11H17F3N4O and a molecular weight of 278.28 g/mol. Its IUPAC name is [5-methyl-2-propyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [5-methyl-2-propyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81001538 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [5-methyl-2-propyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]hydrazine |
| SMILES | CCCc1nc(NN)c(C)c(OC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H17F3N4O/c1-4-5-8-16-9(18-15)6(2)10(17-8)19-7(3)11(12,13)14/h7H,4-5,15H2,1-3H3,(H,16,17,18) |
| InChIKey | XELJVYPDLALIFL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|