C16H20BrNO — CID 81002456
2-bromo-N,N-bis(cyclopropylmethyl)-5-methylbenzamide (PubChem CID 81002456) has the molecular formula C16H20BrNO and a molecular weight of 322.25 g/mol. Its IUPAC name is 2-bromo-N,N-bis(cyclopropylmethyl)-5-methylbenzamide.
| Compound Name | 2-bromo-N,N-bis(cyclopropylmethyl)-5-methylbenzamide |
|---|---|
| PubChem CID | 81002456 |
| Molecular Formula | C16H20BrNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-bromo-N,N-bis(cyclopropylmethyl)-5-methylbenzamide |
| SMILES | Cc1ccc(Br)c(C(=O)N(CC2CC2)CC2CC2)c1 |
| InChI | InChI=1S/C16H20BrNO/c1-11-2-7-15(17)14(8-11)16(19)18(9-12-3-4-12)10-13-5-6-13/h2,7-8,12-13H,3-6,9-10H2,1H3 |
| InChIKey | ZAUXVBQFGVTJRJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |