C11H15BrFNO — CID 81002994
3-[(4-bromo-3-fluorophenyl)methylamino]butan-1-ol (PubChem CID 81002994) has the molecular formula C11H15BrFNO and a molecular weight of 276.15 g/mol. Its IUPAC name is 3-[(4-bromo-3-fluorophenyl)methylamino]butan-1-ol.
| Compound Name | 3-[(4-bromo-3-fluorophenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 81002994 |
| Molecular Formula | C11H15BrFNO |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 3-[(4-bromo-3-fluorophenyl)methylamino]butan-1-ol |
| SMILES | CC(CCO)NCc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H15BrFNO/c1-8(4-5-15)14-7-9-2-3-10(12)11(13)6-9/h2-3,6,8,14-15H,4-5,7H2,1H3 |
| InChIKey | DHYYWCJIZAOEFE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |