C13H23NO4 — CID 81003461
tert-butyl (2R)-2-[(5-methyloxolane-2-carbonyl)amino]propanoate (PubChem CID 81003461) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(5-methyloxolane-2-carbonyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(5-methyloxolane-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 81003461 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl (2R)-2-[(5-methyloxolane-2-carbonyl)amino]propanoate |
| SMILES | CC1CCC(C(=O)N[C@H](C)C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C13H23NO4/c1-8-6-7-10(17-8)11(15)14-9(2)12(16)18-13(3,4)5/h8-10H,6-7H2,1-5H3,(H,14,15)/t8?,9-,10?/m1/s1 |
| InChIKey | DTUJASZTKHHGKZ-HWOCKDDLSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |