C14H27N5 — CID 81007010
6-hydrazinyl-N,5-dimethyl-N-(2-methylbutan-2-yl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 81007010) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is 6-hydrazinyl-N,5-dimethyl-N-(2-methylbutan-2-yl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,5-dimethyl-N-(2-methylbutan-2-yl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 81007010 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | 6-hydrazinyl-N,5-dimethyl-N-(2-methylbutan-2-yl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CCC(C)(C)N(C)c1nc(C(C)C)nc(NN)c1C |
| InChI | InChI=1S/C14H27N5/c1-8-14(5,6)19(7)13-10(4)12(18-15)16-11(17-13)9(2)3/h9H,8,15H2,1-7H3,(H,16,17,18) |
| InChIKey | UTYGZJRKHIKVJW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|