4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid

C15H17BrN2O2 — CID 81007945

IUPAC4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid
SMILESCc1nn(C)c(CCC(C(=O)O)c2ccccc2)c1Br
InChIInChI=1S/C15H17BrN2O2/c1-10-14(16)13(18(2)17-10)9-8-12(15(19)20)11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,19,20)
InChIKeyBBTFKYCFIJMGNY-UHFFFAOYSA-N
MW337.22 g/mol
LogP3.29
Rot. Bonds5

About 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid

4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid (PubChem CID 81007945) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid.

Molecular Properties

Compound Name4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid
PubChem CID81007945
Molecular FormulaC15H17BrN2O2
Molecular Weight337.22 g/mol
Exact Mass336.05
IUPAC Name4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid
SMILESCc1nn(C)c(CCC(C(=O)O)c2ccccc2)c1Br
InChIInChI=1S/C15H17BrN2O2/c1-10-14(16)13(18(2)17-10)9-8-12(15(19)20)11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,19,20)
InChIKeyBBTFKYCFIJMGNY-UHFFFAOYSA-N
XLogP3.29
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.22
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid?
The IUPAC name of 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid (CID 81007945) is 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid.
What is the SMILES notation for 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid?
The canonical SMILES for 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid is Cc1nn(C)c(CCC(C(=O)O)c2ccccc2)c1Br.
What is the InChIKey of 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid?
The InChIKey is BBTFKYCFIJMGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrN2O2/c1-10-14(16)13(18(2)17-10)9-8-12(15(19)20)11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,19,20).
What are the key properties of 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid?
4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid has a molecular weight of 337.22 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-phenylbutanoic acid is sourced from PubChem (CID 81007945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).