C11H13ClO2S — CID 81008089
2-[(5-chlorothiophen-2-yl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 81008089) has the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 81008089 |
| Molecular Formula | C11H13ClO2S |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H13ClO2S/c12-10-5-4-8(15-10)6-7-2-1-3-9(7)11(13)14/h4-5,7,9H,1-3,6H2,(H,13,14) |
| InChIKey | SQEZEOQSHBCBEM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |