C14H14N2O2 — CID 81009067
3-(4-amino-3-pyridinyl)-2-phenylpropanoic acid (PubChem CID 81009067) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(4-amino-3-pyridinyl)-2-phenylpropanoic acid.
| Compound Name | 3-(4-amino-3-pyridinyl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 81009067 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-(4-amino-3-pyridinyl)-2-phenylpropanoic acid |
| SMILES | Nc1ccncc1CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2/c15-13-6-7-16-9-11(13)8-12(14(17)18)10-4-2-1-3-5-10/h1-7,9,12H,8H2,(H2,15,16)(H,17,18) |
| InChIKey | JIGQEQWLAXKBOD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |