C12H13FO2 — CID 81009457
2-[(4-fluorophenyl)methyl]cyclobutane-1-carboxylic acid (PubChem CID 81009457) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81009457 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FO2/c13-10-4-1-8(2-5-10)7-9-3-6-11(9)12(14)15/h1-2,4-5,9,11H,3,6-7H2,(H,14,15) |
| InChIKey | HPNBPHSDYHEIIN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |