C18H29N — CID 81011736
[2-(2,5-dimethylphenyl)-4-propan-2-ylcyclohexyl]methanamine (PubChem CID 81011736) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-4-propan-2-ylcyclohexyl]methanamine.
| Compound Name | [2-(2,5-dimethylphenyl)-4-propan-2-ylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81011736 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-4-propan-2-ylcyclohexyl]methanamine |
| SMILES | Cc1ccc(C)c(C2CC(C(C)C)CCC2CN)c1 |
| InChI | InChI=1S/C18H29N/c1-12(2)15-7-8-16(11-19)18(10-15)17-9-13(3)5-6-14(17)4/h5-6,9,12,15-16,18H,7-8,10-11,19H2,1-4H3 |
| InChIKey | XFFIRFWDVHCXRD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |