C18H27BrFN — CID 81011817
[2-[(3-bromo-5-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanamine (PubChem CID 81011817) has the molecular formula C18H27BrFN and a molecular weight of 356.32 g/mol. Its IUPAC name is [2-[(3-bromo-5-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanamine.
| Compound Name | [2-[(3-bromo-5-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81011817 |
| Molecular Formula | C18H27BrFN |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [2-[(3-bromo-5-fluorophenyl)methyl]-4-tert-butylcyclohexyl]methanamine |
| SMILES | CC(C)(C)C1CCC(CN)C(Cc2cc(F)cc(Br)c2)C1 |
| InChI | InChI=1S/C18H27BrFN/c1-18(2,3)15-5-4-13(11-21)14(9-15)6-12-7-16(19)10-17(20)8-12/h7-8,10,13-15H,4-6,9,11,21H2,1-3H3 |
| InChIKey | JGLPANWEKZCSHB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |