About [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine
[4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine (PubChem CID 81012156) has the molecular formula C17H27NS
and a molecular weight of 277.48 g/mol. Its IUPAC name is [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine |
| PubChem CID | 81012156 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine |
| SMILES | CC1(C)CCC(CN)C(CCSc2ccccc2)C1 |
| InChI | InChI=1S/C17H27NS/c1-17(2)10-8-15(13-18)14(12-17)9-11-19-16-6-4-3-5-7-16/h3-7,14-15H,8-13,18H2,1-2H3 |
| InChIKey | SFDPGZDKVCOPEN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine?
The IUPAC name of [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine (CID 81012156) is [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine.
What is the SMILES notation for [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine?
The canonical SMILES for [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine is CC1(C)CCC(CN)C(CCSc2ccccc2)C1.
What is the InChIKey of [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine?
The InChIKey is SFDPGZDKVCOPEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NS/c1-17(2)10-8-15(13-18)14(12-17)9-11-19-16-6-4-3-5-7-16/h3-7,14-15H,8-13,18H2,1-2H3.
What are the key properties of [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine?
[4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine has a molecular weight of 277.48 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-2-(2-phenylsulfanylethyl)cyclohexyl]methanamine is sourced from PubChem (CID 81012156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).