About [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine
[2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine (PubChem CID 81012326) has the molecular formula C20H31N
and a molecular weight of 285.48 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine.
Molecular Properties
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine |
| PubChem CID | 81012326 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)C(Cc2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C20H31N/c1-2-4-15-7-10-19(14-21)20(11-15)13-16-8-9-17-5-3-6-18(17)12-16/h8-9,12,15,19-20H,2-7,10-11,13-14,21H2,1H3 |
| InChIKey | CWGKJYOWVBEVMK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine?
The IUPAC name of [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine (CID 81012326) is [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine.
What is the SMILES notation for [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine?
The canonical SMILES for [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine is CCCC1CCC(CN)C(Cc2ccc3c(c2)CCC3)C1.
What is the InChIKey of [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine?
The InChIKey is CWGKJYOWVBEVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N/c1-2-4-15-7-10-19(14-21)20(11-15)13-16-8-9-17-5-3-6-18(17)12-16/h8-9,12,15,19-20H,2-7,10-11,13-14,21H2,1H3.
What are the key properties of [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine?
[2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine has a molecular weight of 285.48 g/mol, XLogP of 4.51, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydro-1H-inden-5-ylmethyl)-4-propylcyclohexyl]methanamine is sourced from PubChem (CID 81012326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).