C16H25N — CID 81013913
2-(2-ethylcyclohexyl)-1-phenylethanamine (PubChem CID 81013913) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-(2-ethylcyclohexyl)-1-phenylethanamine.
| Compound Name | 2-(2-ethylcyclohexyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 81013913 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-(2-ethylcyclohexyl)-1-phenylethanamine |
| SMILES | CCC1CCCCC1CC(N)c1ccccc1 |
| InChI | InChI=1S/C16H25N/c1-2-13-8-6-7-11-15(13)12-16(17)14-9-4-3-5-10-14/h3-5,9-10,13,15-16H,2,6-8,11-12,17H2,1H3 |
| InChIKey | RRIYQJQSGGCJIJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |