C14H27NOS — CID 81014334
3-methyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butan-1-amine (PubChem CID 81014334) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is 3-methyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butan-1-amine.
| Compound Name | 3-methyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 81014334 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 3-methyl-3-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butan-1-amine |
| SMILES | CC(C)(CCN)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C14H27NOS/c1-13(2,4-7-15)12-3-8-16-14(11-12)5-9-17-10-6-14/h12H,3-11,15H2,1-2H3 |
| InChIKey | NVVQZTRLFGJZLX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |