C13H27NO — CID 81015192
N-(6-ethoxy-2,3-dimethylhexyl)cyclopropanamine (PubChem CID 81015192) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-(6-ethoxy-2,3-dimethylhexyl)cyclopropanamine.
| Compound Name | N-(6-ethoxy-2,3-dimethylhexyl)cyclopropanamine |
|---|---|
| PubChem CID | 81015192 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-(6-ethoxy-2,3-dimethylhexyl)cyclopropanamine |
| SMILES | CCOCCCC(C)C(C)CNC1CC1 |
| InChI | InChI=1S/C13H27NO/c1-4-15-9-5-6-11(2)12(3)10-14-13-7-8-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | VAHFRLGKADSFDC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|