C12H27N — CID 81015380
2,3-dimethyl-N-propylheptan-1-amine (PubChem CID 81015380) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is 2,3-dimethyl-N-propylheptan-1-amine.
| Compound Name | 2,3-dimethyl-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 81015380 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 2,3-dimethyl-N-propylheptan-1-amine |
| SMILES | CCCCC(C)C(C)CNCCC |
| InChI | InChI=1S/C12H27N/c1-5-7-8-11(3)12(4)10-13-9-6-2/h11-13H,5-10H2,1-4H3 |
| InChIKey | RVTSXPVZZGINFY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|