About N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine
N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine (PubChem CID 81016607) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine.
Molecular Properties
| Compound Name | N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine |
| PubChem CID | 81016607 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine |
| SMILES | C=C(C)CC(C)C(C)CNC1CC1 |
| InChI | InChI=1S/C12H23N/c1-9(2)7-10(3)11(4)8-13-12-5-6-12/h10-13H,1,5-8H2,2-4H3 |
| InChIKey | WPYIGNRVJROCOJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine?
The IUPAC name of N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine (CID 81016607) is N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine.
What is the SMILES notation for N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine?
The canonical SMILES for N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine is C=C(C)CC(C)C(C)CNC1CC1.
What is the InChIKey of N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine?
The InChIKey is WPYIGNRVJROCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-9(2)7-10(3)11(4)8-13-12-5-6-12/h10-13H,1,5-8H2,2-4H3.
What are the key properties of N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine?
N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine has a molecular weight of 181.32 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3,5-trimethylhex-5-enyl)cyclopropanamine is sourced from PubChem (CID 81016607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).