C16H22O2S — CID 81021281
4-methyl-2-(2-phenylsulfanylethyl)cyclohexane-1-carboxylic acid (PubChem CID 81021281) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-methyl-2-(2-phenylsulfanylethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-2-(2-phenylsulfanylethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81021281 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-methyl-2-(2-phenylsulfanylethyl)cyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)C(CCSc2ccccc2)C1 |
| InChI | InChI=1S/C16H22O2S/c1-12-7-8-15(16(17)18)13(11-12)9-10-19-14-5-3-2-4-6-14/h2-6,12-13,15H,7-11H2,1H3,(H,17,18) |
| InChIKey | SEJVYIZXZCZGOV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |