C15H21N — CID 81024536
N-(2-phenylhex-5-enyl)cyclopropanamine (PubChem CID 81024536) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(2-phenylhex-5-enyl)cyclopropanamine.
| Compound Name | N-(2-phenylhex-5-enyl)cyclopropanamine |
|---|---|
| PubChem CID | 81024536 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(2-phenylhex-5-enyl)cyclopropanamine |
| SMILES | C=CCCC(CNC1CC1)c1ccccc1 |
| InChI | InChI=1S/C15H21N/c1-2-3-7-14(12-16-15-10-11-15)13-8-5-4-6-9-13/h2,4-6,8-9,14-16H,1,3,7,10-12H2 |
| InChIKey | FSYUQDRHONFUQR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|