C16H26ClNS — CID 81025130
N-[[2-(5-chlorothiophen-2-yl)cycloheptyl]methyl]-2-methylpropan-2-amine (PubChem CID 81025130) has the molecular formula C16H26ClNS and a molecular weight of 299.91 g/mol. Its IUPAC name is N-[[2-(5-chlorothiophen-2-yl)cycloheptyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-(5-chlorothiophen-2-yl)cycloheptyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 81025130 |
| Molecular Formula | C16H26ClNS |
| Molecular Weight | 299.91 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[[2-(5-chlorothiophen-2-yl)cycloheptyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCCCCC1c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H26ClNS/c1-16(2,3)18-11-12-7-5-4-6-8-13(12)14-9-10-15(17)19-14/h9-10,12-13,18H,4-8,11H2,1-3H3 |
| InChIKey | AROPORHFKVFOQC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |